C21H31FN6S — CID 109420808
3-[3-[4-(2-fluorophenyl)piperazin-1-yl]propyl]-1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine (PubChem CID 109420808) has the molecular formula C21H31FN6S and a molecular weight of 418.59 g/mol. Its IUPAC name is 3-[3-[4-(2-fluorophenyl)piperazin-1-yl]propyl]-1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine.
| Compound Name | 3-[3-[4-(2-fluorophenyl)piperazin-1-yl]propyl]-1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine |
|---|---|
| PubChem CID | 109420808 |
| Molecular Formula | C21H31FN6S |
| Molecular Weight | 418.59 g/mol |
| Exact Mass | 418.23 |
| IUPAC Name | 3-[3-[4-(2-fluorophenyl)piperazin-1-yl]propyl]-1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine |
| SMILES | C/N=C(/NCCCN1CCN(c2ccccc2F)CC1)N(C)Cc1csc(C)n1 |
| InChI | InChI=1S/C21H31FN6S/c1-17-25-18(16-29-17)15-26(3)21(23-2)24-9-6-10-27-11-13-28(14-12-27)20-8-5-4-7-19(20)22/h4-5,7-8,16H,6,9-15H2,1-3H3,(H,23,24) |
| InChIKey | OUMQIRUNYYEQAQ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 47.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.59 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|