C19H30N8S — CID 109425010
1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]-3-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]guanidine (PubChem CID 109425010) has the molecular formula C19H30N8S and a molecular weight of 402.57 g/mol. Its IUPAC name is 1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]-3-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]guanidine.
| Compound Name | 1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]-3-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]guanidine |
|---|---|
| PubChem CID | 109425010 |
| Molecular Formula | C19H30N8S |
| Molecular Weight | 402.57 g/mol |
| Exact Mass | 402.23 |
| IUPAC Name | 1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]-3-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]guanidine |
| SMILES | C/N=C(/NCCCN1CCN(c2ncccn2)CC1)N(C)Cc1csc(C)n1 |
| InChI | InChI=1S/C19H30N8S/c1-16-24-17(15-28-16)14-25(3)18(20-2)21-8-5-9-26-10-12-27(13-11-26)19-22-6-4-7-23-19/h4,6-7,15H,5,8-14H2,1-3H3,(H,20,21) |
| InChIKey | YMXBQNLBKQUXLT-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 72.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.57 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|