C16H27IN6S — CID 109420773
1,2-dimethyl-3-[4-(2-methylimidazol-1-yl)butyl]-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine;hydroiodide (PubChem CID 109420773) has the molecular formula C16H27IN6S and a molecular weight of 462.41 g/mol. Its IUPAC name is 1,2-dimethyl-3-[4-(2-methylimidazol-1-yl)butyl]-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1,2-dimethyl-3-[4-(2-methylimidazol-1-yl)butyl]-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109420773 |
| Molecular Formula | C16H27IN6S |
| Molecular Weight | 462.41 g/mol |
| Exact Mass | 462.11 |
| IUPAC Name | 1,2-dimethyl-3-[4-(2-methylimidazol-1-yl)butyl]-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCCCn1ccnc1C)N(C)Cc1csc(C)n1.I |
| InChI | InChI=1S/C16H26N6S.HI/c1-13-18-8-10-22(13)9-6-5-7-19-16(17-3)21(4)11-15-12-23-14(2)20-15;/h8,10,12H,5-7,9,11H2,1-4H3,(H,17,19);1H |
| InChIKey | VTHOLKBYZMZUCH-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 58.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.41 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|