C21H31N7 — CID 110951912
1-benzyl-1,2-dimethyl-3-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]guanidine (PubChem CID 110951912) has the molecular formula C21H31N7 and a molecular weight of 381.53 g/mol. Its IUPAC name is 1-benzyl-1,2-dimethyl-3-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]guanidine.
| Compound Name | 1-benzyl-1,2-dimethyl-3-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]guanidine |
|---|---|
| PubChem CID | 110951912 |
| Molecular Formula | C21H31N7 |
| Molecular Weight | 381.53 g/mol |
| Exact Mass | 381.26 |
| IUPAC Name | 1-benzyl-1,2-dimethyl-3-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]guanidine |
| SMILES | C/N=C(/NCCCN1CCN(c2ncccn2)CC1)N(C)Cc1ccccc1 |
| InChI | InChI=1S/C21H31N7/c1-22-20(26(2)18-19-8-4-3-5-9-19)23-12-7-13-27-14-16-28(17-15-27)21-24-10-6-11-25-21/h3-6,8-11H,7,12-18H2,1-2H3,(H,22,23) |
| InChIKey | GVVJPWINVKXRFJ-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 59.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.53 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|