C19H25IN6S — CID 109421549
1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]-3-[2-(4-pyrazol-1-ylphenyl)ethyl]guanidine;hydroiodide (PubChem CID 109421549) has the molecular formula C19H25IN6S and a molecular weight of 496.42 g/mol. Its IUPAC name is 1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]-3-[2-(4-pyrazol-1-ylphenyl)ethyl]guanidine;hydroiodide.
| Compound Name | 1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]-3-[2-(4-pyrazol-1-ylphenyl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109421549 |
| Molecular Formula | C19H25IN6S |
| Molecular Weight | 496.42 g/mol |
| Exact Mass | 496.09 |
| IUPAC Name | 1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]-3-[2-(4-pyrazol-1-ylphenyl)ethyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCCc1ccc(-n2cccn2)cc1)N(C)Cc1csc(C)n1.I |
| InChI | InChI=1S/C19H24N6S.HI/c1-15-23-17(14-26-15)13-24(3)19(20-2)21-11-9-16-5-7-18(8-6-16)25-12-4-10-22-25;/h4-8,10,12,14H,9,11,13H2,1-3H3,(H,20,21);1H |
| InChIKey | UDLSIXVRNRRBGK-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 58.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.42 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|