C19H24FIN6S — CID 109420817
3-[2-[1-(4-fluorophenyl)pyrazol-3-yl]ethyl]-1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine;hydroiodide (PubChem CID 109420817) has the molecular formula C19H24FIN6S and a molecular weight of 514.41 g/mol. Its IUPAC name is 3-[2-[1-(4-fluorophenyl)pyrazol-3-yl]ethyl]-1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine;hydroiodide.
| Compound Name | 3-[2-[1-(4-fluorophenyl)pyrazol-3-yl]ethyl]-1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109420817 |
| Molecular Formula | C19H24FIN6S |
| Molecular Weight | 514.41 g/mol |
| Exact Mass | 514.08 |
| IUPAC Name | 3-[2-[1-(4-fluorophenyl)pyrazol-3-yl]ethyl]-1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCCc1ccn(-c2ccc(F)cc2)n1)N(C)Cc1csc(C)n1.I |
| InChI | InChI=1S/C19H23FN6S.HI/c1-14-23-17(13-27-14)12-25(3)19(21-2)22-10-8-16-9-11-26(24-16)18-6-4-15(20)5-7-18;/h4-7,9,11,13H,8,10,12H2,1-3H3,(H,21,22);1H |
| InChIKey | RVDACVODQKLSTP-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 58.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.41 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|