C17H27N3O2S — CID 111299071
methyl 5-[[N,N'-dimethyl-N-[(4-methylsulfanylphenyl)methyl]carbamimidoyl]amino]pentanoate (PubChem CID 111299071) has the molecular formula C17H27N3O2S and a molecular weight of 337.49 g/mol. Its IUPAC name is methyl 5-[[N,N'-dimethyl-N-[(4-methylsulfanylphenyl)methyl]carbamimidoyl]amino]pentanoate.
| Compound Name | methyl 5-[[N,N'-dimethyl-N-[(4-methylsulfanylphenyl)methyl]carbamimidoyl]amino]pentanoate |
|---|---|
| PubChem CID | 111299071 |
| Molecular Formula | C17H27N3O2S |
| Molecular Weight | 337.49 g/mol |
| Exact Mass | 337.18 |
| IUPAC Name | methyl 5-[[N,N'-dimethyl-N-[(4-methylsulfanylphenyl)methyl]carbamimidoyl]amino]pentanoate |
| SMILES | C/N=C(\NCCCCC(=O)OC)N(C)Cc1ccc(SC)cc1 |
| InChI | InChI=1S/C17H27N3O2S/c1-18-17(19-12-6-5-7-16(21)22-3)20(2)13-14-8-10-15(23-4)11-9-14/h8-11H,5-7,12-13H2,1-4H3,(H,18,19) |
| InChIKey | YLBMNXUDOCBKTD-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.49 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|