C23H30IN5S — CID 111299450
3-[2-(1-benzylimidazol-2-yl)ethyl]-1,2-dimethyl-1-[(4-methylsulfanylphenyl)methyl]guanidine;hydroiodide (PubChem CID 111299450) has the molecular formula C23H30IN5S and a molecular weight of 535.50 g/mol. Its IUPAC name is 3-[2-(1-benzylimidazol-2-yl)ethyl]-1,2-dimethyl-1-[(4-methylsulfanylphenyl)methyl]guanidine;hydroiodide.
| Compound Name | 3-[2-(1-benzylimidazol-2-yl)ethyl]-1,2-dimethyl-1-[(4-methylsulfanylphenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111299450 |
| Molecular Formula | C23H30IN5S |
| Molecular Weight | 535.50 g/mol |
| Exact Mass | 535.13 |
| IUPAC Name | 3-[2-(1-benzylimidazol-2-yl)ethyl]-1,2-dimethyl-1-[(4-methylsulfanylphenyl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCc1nccn1Cc1ccccc1)N(C)Cc1ccc(SC)cc1.I |
| InChI | InChI=1S/C23H29N5S.HI/c1-24-23(27(2)17-20-9-11-21(29-3)12-10-20)26-14-13-22-25-15-16-28(22)18-19-7-5-4-6-8-19;/h4-12,15-16H,13-14,17-18H2,1-3H3,(H,24,26);1H |
| InChIKey | ISXDKNKXIYVZCN-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 45.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.50 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|