C19H18FN3O3 — CID 108875104
1-[2-(1,3-dioxoisoindol-2-yl)ethyl]-3-[2-(3-fluorophenyl)ethyl]urea (PubChem CID 108875104) has the molecular formula C19H18FN3O3 and a molecular weight of 355.37 g/mol. Its IUPAC name is 1-[2-(1,3-dioxoisoindol-2-yl)ethyl]-3-[2-(3-fluorophenyl)ethyl]urea.
| Compound Name | 1-[2-(1,3-dioxoisoindol-2-yl)ethyl]-3-[2-(3-fluorophenyl)ethyl]urea |
|---|---|
| PubChem CID | 108875104 |
| Molecular Formula | C19H18FN3O3 |
| Molecular Weight | 355.37 g/mol |
| Exact Mass | 355.13 |
| IUPAC Name | 1-[2-(1,3-dioxoisoindol-2-yl)ethyl]-3-[2-(3-fluorophenyl)ethyl]urea |
| SMILES | O=C(NCCc1cccc(F)c1)NCCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C19H18FN3O3/c20-14-5-3-4-13(12-14)8-9-21-19(26)22-10-11-23-17(24)15-6-1-2-7-16(15)18(23)25/h1-7,12H,8-11H2,(H2,21,22,26) |
| InChIKey | BCEHLHMTTZTINF-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.37 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|