C18H25N3O3 — CID 111976858
1-[3-(3,5-dimethyl-1,2-oxazol-4-yl)propyl]-3-(1-hydroxy-3-phenylpropan-2-yl)urea (PubChem CID 111976858) has the molecular formula C18H25N3O3 and a molecular weight of 331.42 g/mol. Its IUPAC name is 1-[3-(3,5-dimethyl-1,2-oxazol-4-yl)propyl]-3-(1-hydroxy-3-phenylpropan-2-yl)urea.
| Compound Name | 1-[3-(3,5-dimethyl-1,2-oxazol-4-yl)propyl]-3-(1-hydroxy-3-phenylpropan-2-yl)urea |
|---|---|
| PubChem CID | 111976858 |
| Molecular Formula | C18H25N3O3 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.19 |
| IUPAC Name | 1-[3-(3,5-dimethyl-1,2-oxazol-4-yl)propyl]-3-(1-hydroxy-3-phenylpropan-2-yl)urea |
| SMILES | Cc1noc(C)c1CCCNC(=O)NC(CO)Cc1ccccc1 |
| InChI | InChI=1S/C18H25N3O3/c1-13-17(14(2)24-21-13)9-6-10-19-18(23)20-16(12-22)11-15-7-4-3-5-8-15/h3-5,7-8,16,22H,6,9-12H2,1-2H3,(H2,19,20,23) |
| InChIKey | PMTIKKNJAAOLGO-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 87.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|