C19H31ClIN5O — CID 111186472
4-(3-chlorophenyl)-N-ethyl-N'-[(4-methylmorpholin-2-yl)methyl]piperazine-1-carboximidamide;hydroiodide (PubChem CID 111186472) has the molecular formula C19H31ClIN5O and a molecular weight of 507.85 g/mol. Its IUPAC name is 4-(3-chlorophenyl)-N-ethyl-N'-[(4-methylmorpholin-2-yl)methyl]piperazine-1-carboximidamide;hydroiodide.
| Compound Name | 4-(3-chlorophenyl)-N-ethyl-N'-[(4-methylmorpholin-2-yl)methyl]piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111186472 |
| Molecular Formula | C19H31ClIN5O |
| Molecular Weight | 507.85 g/mol |
| Exact Mass | 507.13 |
| IUPAC Name | 4-(3-chlorophenyl)-N-ethyl-N'-[(4-methylmorpholin-2-yl)methyl]piperazine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CC1CN(C)CCO1)N1CCN(c2cccc(Cl)c2)CC1.I |
| InChI | InChI=1S/C19H30ClN5O.HI/c1-3-21-19(22-14-18-15-23(2)11-12-26-18)25-9-7-24(8-10-25)17-6-4-5-16(20)13-17;/h4-6,13,18H,3,7-12,14-15H2,1-2H3,(H,21,22);1H |
| InChIKey | NWCZKYFESQSEHL-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 43.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.85 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|