C18H29ClIN5O2S — CID 111186948
4-(3-chlorophenyl)-N'-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]-N-ethylpiperazine-1-carboximidamide;hydroiodide (PubChem CID 111186948) has the molecular formula C18H29ClIN5O2S and a molecular weight of 541.89 g/mol. Its IUPAC name is 4-(3-chlorophenyl)-N'-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]-N-ethylpiperazine-1-carboximidamide;hydroiodide.
| Compound Name | 4-(3-chlorophenyl)-N'-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]-N-ethylpiperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111186948 |
| Molecular Formula | C18H29ClIN5O2S |
| Molecular Weight | 541.89 g/mol |
| Exact Mass | 541.08 |
| IUPAC Name | 4-(3-chlorophenyl)-N'-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]-N-ethylpiperazine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CCN1CCCS1(=O)=O)N1CCN(c2cccc(Cl)c2)CC1.I |
| InChI | InChI=1S/C18H28ClN5O2S.HI/c1-2-20-18(21-7-9-24-8-4-14-27(24,25)26)23-12-10-22(11-13-23)17-6-3-5-16(19)15-17;/h3,5-6,15H,2,4,7-14H2,1H3,(H,20,21);1H |
| InChIKey | QLKJLAMYMUVTCH-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 68.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.89 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|