C22H34N6O — CID 111243295
N'-[3-(3,5-dimethylpyrazol-1-yl)propyl]-N-ethyl-4-(4-methoxyphenyl)piperazine-1-carboximidamide (PubChem CID 111243295) has the molecular formula C22H34N6O and a molecular weight of 398.56 g/mol. Its IUPAC name is N'-[3-(3,5-dimethylpyrazol-1-yl)propyl]-N-ethyl-4-(4-methoxyphenyl)piperazine-1-carboximidamide.
| Compound Name | N'-[3-(3,5-dimethylpyrazol-1-yl)propyl]-N-ethyl-4-(4-methoxyphenyl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111243295 |
| Molecular Formula | C22H34N6O |
| Molecular Weight | 398.56 g/mol |
| Exact Mass | 398.28 |
| IUPAC Name | N'-[3-(3,5-dimethylpyrazol-1-yl)propyl]-N-ethyl-4-(4-methoxyphenyl)piperazine-1-carboximidamide |
| SMILES | CCN/C(=N\CCCn1nc(C)cc1C)N1CCN(c2ccc(OC)cc2)CC1 |
| InChI | InChI=1S/C22H34N6O/c1-5-23-22(24-11-6-12-28-19(3)17-18(2)25-28)27-15-13-26(14-16-27)20-7-9-21(29-4)10-8-20/h7-10,17H,5-6,11-16H2,1-4H3,(H,23,24) |
| InChIKey | UEVLGLSHOHBHIW-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 57.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.56 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|