C16H30IN3O3 — CID 110994484
ethyl 1-[N'-methyl-N-[2-(oxolan-2-yl)ethyl]carbamimidoyl]piperidine-3-carboxylate;hydroiodide (PubChem CID 110994484) has the molecular formula C16H30IN3O3 and a molecular weight of 439.34 g/mol. Its IUPAC name is ethyl 1-[N'-methyl-N-[2-(oxolan-2-yl)ethyl]carbamimidoyl]piperidine-3-carboxylate;hydroiodide.
| Compound Name | ethyl 1-[N'-methyl-N-[2-(oxolan-2-yl)ethyl]carbamimidoyl]piperidine-3-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 110994484 |
| Molecular Formula | C16H30IN3O3 |
| Molecular Weight | 439.34 g/mol |
| Exact Mass | 439.13 |
| IUPAC Name | ethyl 1-[N'-methyl-N-[2-(oxolan-2-yl)ethyl]carbamimidoyl]piperidine-3-carboxylate;hydroiodide |
| SMILES | CCOC(=O)C1CCCN(/C(=N/C)NCCC2CCCO2)C1.I |
| InChI | InChI=1S/C16H29N3O3.HI/c1-3-21-15(20)13-6-4-10-19(12-13)16(17-2)18-9-8-14-7-5-11-22-14;/h13-14H,3-12H2,1-2H3,(H,17,18);1H |
| InChIKey | HNMFPCMQNYVNJV-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 63.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.34 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|