C15H28IN3O3 — CID 110994002
ethyl 1-[N'-methyl-N-(oxolan-2-ylmethyl)carbamimidoyl]piperidine-3-carboxylate;hydroiodide (PubChem CID 110994002) has the molecular formula C15H28IN3O3 and a molecular weight of 425.31 g/mol. Its IUPAC name is ethyl 1-[N'-methyl-N-(oxolan-2-ylmethyl)carbamimidoyl]piperidine-3-carboxylate;hydroiodide.
| Compound Name | ethyl 1-[N'-methyl-N-(oxolan-2-ylmethyl)carbamimidoyl]piperidine-3-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 110994002 |
| Molecular Formula | C15H28IN3O3 |
| Molecular Weight | 425.31 g/mol |
| Exact Mass | 425.12 |
| IUPAC Name | ethyl 1-[N'-methyl-N-(oxolan-2-ylmethyl)carbamimidoyl]piperidine-3-carboxylate;hydroiodide |
| SMILES | CCOC(=O)C1CCCN(/C(=N/C)NCC2CCCO2)C1.I |
| InChI | InChI=1S/C15H27N3O3.HI/c1-3-20-14(19)12-6-4-8-18(11-12)15(16-2)17-10-13-7-5-9-21-13;/h12-13H,3-11H2,1-2H3,(H,16,17);1H |
| InChIKey | DVNICDUYWVDRBA-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 63.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.31 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|