C21H34N4O2S — CID 110993375
ethyl 1-[N'-methyl-N-[[1-(thiophen-2-ylmethyl)piperidin-3-yl]methyl]carbamimidoyl]piperidine-3-carboxylate (PubChem CID 110993375) has the molecular formula C21H34N4O2S and a molecular weight of 406.60 g/mol. Its IUPAC name is ethyl 1-[N'-methyl-N-[[1-(thiophen-2-ylmethyl)piperidin-3-yl]methyl]carbamimidoyl]piperidine-3-carboxylate.
| Compound Name | ethyl 1-[N'-methyl-N-[[1-(thiophen-2-ylmethyl)piperidin-3-yl]methyl]carbamimidoyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 110993375 |
| Molecular Formula | C21H34N4O2S |
| Molecular Weight | 406.60 g/mol |
| Exact Mass | 406.24 |
| IUPAC Name | ethyl 1-[N'-methyl-N-[[1-(thiophen-2-ylmethyl)piperidin-3-yl]methyl]carbamimidoyl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)C1CCCN(/C(=N/C)NCC2CCCN(Cc3cccs3)C2)C1 |
| InChI | InChI=1S/C21H34N4O2S/c1-3-27-20(26)18-8-5-11-25(15-18)21(22-2)23-13-17-7-4-10-24(14-17)16-19-9-6-12-28-19/h6,9,12,17-18H,3-5,7-8,10-11,13-16H2,1-2H3,(H,22,23) |
| InChIKey | SRDDABAKMUGVEJ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 57.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.60 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|