C22H35N5O2S — CID 111302135
N'-methyl-4-(oxolane-2-carbonyl)-N-[[1-(thiophen-2-ylmethyl)piperidin-3-yl]methyl]piperazine-1-carboximidamide (PubChem CID 111302135) has the molecular formula C22H35N5O2S and a molecular weight of 433.62 g/mol. Its IUPAC name is N'-methyl-4-(oxolane-2-carbonyl)-N-[[1-(thiophen-2-ylmethyl)piperidin-3-yl]methyl]piperazine-1-carboximidamide.
| Compound Name | N'-methyl-4-(oxolane-2-carbonyl)-N-[[1-(thiophen-2-ylmethyl)piperidin-3-yl]methyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111302135 |
| Molecular Formula | C22H35N5O2S |
| Molecular Weight | 433.62 g/mol |
| Exact Mass | 433.25 |
| IUPAC Name | N'-methyl-4-(oxolane-2-carbonyl)-N-[[1-(thiophen-2-ylmethyl)piperidin-3-yl]methyl]piperazine-1-carboximidamide |
| SMILES | C/N=C(\NCC1CCCN(Cc2cccs2)C1)N1CCN(C(=O)C2CCCO2)CC1 |
| InChI | InChI=1S/C22H35N5O2S/c1-23-22(27-11-9-26(10-12-27)21(28)20-7-3-13-29-20)24-15-18-5-2-8-25(16-18)17-19-6-4-14-30-19/h4,6,14,18,20H,2-3,5,7-13,15-17H2,1H3,(H,23,24) |
| InChIKey | UMPJUVBIYOPZQL-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 60.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.62 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|