C20H40IN7O — CID 111537493
1-[5-(diethylamino)pentan-2-yl]-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-(oxolan-2-ylmethyl)guanidine;hydroiodide (PubChem CID 111537493) has the molecular formula C20H40IN7O and a molecular weight of 521.49 g/mol. Its IUPAC name is 1-[5-(diethylamino)pentan-2-yl]-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-(oxolan-2-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-[5-(diethylamino)pentan-2-yl]-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-(oxolan-2-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111537493 |
| Molecular Formula | C20H40IN7O |
| Molecular Weight | 521.49 g/mol |
| Exact Mass | 521.23 |
| IUPAC Name | 1-[5-(diethylamino)pentan-2-yl]-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-(oxolan-2-ylmethyl)guanidine;hydroiodide |
| SMILES | CCN(CC)CCCC(C)N/C(=N/Cc1nnc(C)n1C)NCC1CCCO1.I |
| InChI | InChI=1S/C20H39N7O.HI/c1-6-27(7-2)12-8-10-16(3)23-20(21-14-18-11-9-13-28-18)22-15-19-25-24-17(4)26(19)5;/h16,18H,6-15H2,1-5H3,(H2,21,22,23);1H |
| InChIKey | OMDKTYIKYHQGTF-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 79.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.49 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|