C20H29N7O3 — CID 111539261
N'-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-4-(furan-2-carbonyl)-N-(oxolan-2-ylmethyl)piperazine-1-carboximidamide (PubChem CID 111539261) has the molecular formula C20H29N7O3 and a molecular weight of 415.50 g/mol. Its IUPAC name is N'-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-4-(furan-2-carbonyl)-N-(oxolan-2-ylmethyl)piperazine-1-carboximidamide.
| Compound Name | N'-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-4-(furan-2-carbonyl)-N-(oxolan-2-ylmethyl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111539261 |
| Molecular Formula | C20H29N7O3 |
| Molecular Weight | 415.50 g/mol |
| Exact Mass | 415.23 |
| IUPAC Name | N'-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-4-(furan-2-carbonyl)-N-(oxolan-2-ylmethyl)piperazine-1-carboximidamide |
| SMILES | Cc1nnc(C/N=C(\NCC2CCCO2)N2CCN(C(=O)c3ccco3)CC2)n1C |
| InChI | InChI=1S/C20H29N7O3/c1-15-23-24-18(25(15)2)14-22-20(21-13-16-5-3-11-29-16)27-9-7-26(8-10-27)19(28)17-6-4-12-30-17/h4,6,12,16H,3,5,7-11,13-14H2,1-2H3,(H,21,22) |
| InChIKey | OXENPRPGPFRWMV-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 101.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.50 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|