C18H27N3OS2 — CID 109419280
1-ethyl-2-(2-hydroxy-2-thiophen-2-ylpropyl)-3-(2-methyl-3-thiophen-2-ylpropyl)guanidine (PubChem CID 109419280) has the molecular formula C18H27N3OS2 and a molecular weight of 365.57 g/mol. Its IUPAC name is 1-ethyl-2-(2-hydroxy-2-thiophen-2-ylpropyl)-3-(2-methyl-3-thiophen-2-ylpropyl)guanidine.
| Compound Name | 1-ethyl-2-(2-hydroxy-2-thiophen-2-ylpropyl)-3-(2-methyl-3-thiophen-2-ylpropyl)guanidine |
|---|---|
| PubChem CID | 109419280 |
| Molecular Formula | C18H27N3OS2 |
| Molecular Weight | 365.57 g/mol |
| Exact Mass | 365.16 |
| IUPAC Name | 1-ethyl-2-(2-hydroxy-2-thiophen-2-ylpropyl)-3-(2-methyl-3-thiophen-2-ylpropyl)guanidine |
| SMILES | CCN/C(=N\CC(C)(O)c1cccs1)NCC(C)Cc1cccs1 |
| InChI | InChI=1S/C18H27N3OS2/c1-4-19-17(20-12-14(2)11-15-7-5-9-23-15)21-13-18(3,22)16-8-6-10-24-16/h5-10,14,22H,4,11-13H2,1-3H3,(H2,19,20,21) |
| InChIKey | OGZLSCPSNDDMPR-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.57 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|