C20H36N4O3S — CID 109420322
tert-butyl N-[3-[[N-ethyl-N'-(2-hydroxy-2-thiophen-2-ylpropyl)carbamimidoyl]amino]-2-methylpropyl]-N-methylcarbamate (PubChem CID 109420322) has the molecular formula C20H36N4O3S and a molecular weight of 412.60 g/mol. Its IUPAC name is tert-butyl N-[3-[[N-ethyl-N'-(2-hydroxy-2-thiophen-2-ylpropyl)carbamimidoyl]amino]-2-methylpropyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[3-[[N-ethyl-N'-(2-hydroxy-2-thiophen-2-ylpropyl)carbamimidoyl]amino]-2-methylpropyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 109420322 |
| Molecular Formula | C20H36N4O3S |
| Molecular Weight | 412.60 g/mol |
| Exact Mass | 412.25 |
| IUPAC Name | tert-butyl N-[3-[[N-ethyl-N'-(2-hydroxy-2-thiophen-2-ylpropyl)carbamimidoyl]amino]-2-methylpropyl]-N-methylcarbamate |
| SMILES | CCN/C(=N\CC(C)(O)c1cccs1)NCC(C)CN(C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H36N4O3S/c1-8-21-17(23-14-20(6,26)16-10-9-11-28-16)22-12-15(2)13-24(7)18(25)27-19(3,4)5/h9-11,15,26H,8,12-14H2,1-7H3,(H2,21,22,23) |
| InChIKey | QDIZXGSNTBIUQT-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 86.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.60 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|