C21H32IN3O4S — CID 109418915
1-[3-(3,5-dimethoxyphenoxy)propyl]-3-ethyl-2-(2-hydroxy-2-thiophen-2-ylpropyl)guanidine;hydroiodide (PubChem CID 109418915) has the molecular formula C21H32IN3O4S and a molecular weight of 549.48 g/mol. Its IUPAC name is 1-[3-(3,5-dimethoxyphenoxy)propyl]-3-ethyl-2-(2-hydroxy-2-thiophen-2-ylpropyl)guanidine;hydroiodide.
| Compound Name | 1-[3-(3,5-dimethoxyphenoxy)propyl]-3-ethyl-2-(2-hydroxy-2-thiophen-2-ylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 109418915 |
| Molecular Formula | C21H32IN3O4S |
| Molecular Weight | 549.48 g/mol |
| Exact Mass | 549.12 |
| IUPAC Name | 1-[3-(3,5-dimethoxyphenoxy)propyl]-3-ethyl-2-(2-hydroxy-2-thiophen-2-ylpropyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(C)(O)c1cccs1)NCCCOc1cc(OC)cc(OC)c1.I |
| InChI | InChI=1S/C21H31N3O4S.HI/c1-5-22-20(24-15-21(2,25)19-8-6-11-29-19)23-9-7-10-28-18-13-16(26-3)12-17(14-18)27-4;/h6,8,11-14,25H,5,7,9-10,15H2,1-4H3,(H2,22,23,24);1H |
| InChIKey | DWIDOAMHRFKVJE-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 84.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.48 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|