C18H25BrFIN4O — CID 111592344
1-[2-(3-bromo-4-fluorophenyl)ethyl]-3-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-2-methylguanidine;hydroiodide (PubChem CID 111592344) has the molecular formula C18H25BrFIN4O and a molecular weight of 539.23 g/mol. Its IUPAC name is 1-[2-(3-bromo-4-fluorophenyl)ethyl]-3-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[2-(3-bromo-4-fluorophenyl)ethyl]-3-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111592344 |
| Molecular Formula | C18H25BrFIN4O |
| Molecular Weight | 539.23 g/mol |
| Exact Mass | 538.02 |
| IUPAC Name | 1-[2-(3-bromo-4-fluorophenyl)ethyl]-3-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(/NCCc1ccc(F)c(Br)c1)NCc1ncc(C(C)(C)C)o1.I |
| InChI | InChI=1S/C18H24BrFN4O.HI/c1-18(2,3)15-10-23-16(25-15)11-24-17(21-4)22-8-7-12-5-6-14(20)13(19)9-12;/h5-6,9-10H,7-8,11H2,1-4H3,(H2,21,22,24);1H |
| InChIKey | PCDFQPBEDWQYIO-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 62.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.23 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|