C16H19BrFIN4 — CID 110968707
1-[2-(3-bromo-4-fluorophenyl)ethyl]-2-methyl-3-(pyridin-2-ylmethyl)guanidine;hydroiodide (PubChem CID 110968707) has the molecular formula C16H19BrFIN4 and a molecular weight of 493.16 g/mol. Its IUPAC name is 1-[2-(3-bromo-4-fluorophenyl)ethyl]-2-methyl-3-(pyridin-2-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-[2-(3-bromo-4-fluorophenyl)ethyl]-2-methyl-3-(pyridin-2-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 110968707 |
| Molecular Formula | C16H19BrFIN4 |
| Molecular Weight | 493.16 g/mol |
| Exact Mass | 491.98 |
| IUPAC Name | 1-[2-(3-bromo-4-fluorophenyl)ethyl]-2-methyl-3-(pyridin-2-ylmethyl)guanidine;hydroiodide |
| SMILES | C/N=C(/NCCc1ccc(F)c(Br)c1)NCc1ccccn1.I |
| InChI | InChI=1S/C16H18BrFN4.HI/c1-19-16(22-11-13-4-2-3-8-20-13)21-9-7-12-5-6-15(18)14(17)10-12;/h2-6,8,10H,7,9,11H2,1H3,(H2,19,21,22);1H |
| InChIKey | KDUCKUBPKRPILQ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 49.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.16 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|