C15H19F4N3O4S — CID 166182282
1-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-3-(2-morpholin-4-ylsulfonylethyl)urea (PubChem CID 166182282) has the molecular formula C15H19F4N3O4S and a molecular weight of 413.39 g/mol. Its IUPAC name is 1-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-3-(2-morpholin-4-ylsulfonylethyl)urea.
| Compound Name | 1-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-3-(2-morpholin-4-ylsulfonylethyl)urea |
|---|---|
| PubChem CID | 166182282 |
| Molecular Formula | C15H19F4N3O4S |
| Molecular Weight | 413.39 g/mol |
| Exact Mass | 413.10 |
| IUPAC Name | 1-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-3-(2-morpholin-4-ylsulfonylethyl)urea |
| SMILES | O=C(NCCS(=O)(=O)N1CCOCC1)NCc1ccc(F)cc1C(F)(F)F |
| InChI | InChI=1S/C15H19F4N3O4S/c16-12-2-1-11(13(9-12)15(17,18)19)10-21-14(23)20-3-8-27(24,25)22-4-6-26-7-5-22/h1-2,9H,3-8,10H2,(H2,20,21,23) |
| InChIKey | JRFLVTQKDWWFCC-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.39 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |