C20H21F4N3O — CID 55696395
1-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-3-(2-piperidin-1-ylphenyl)urea (PubChem CID 55696395) has the molecular formula C20H21F4N3O and a molecular weight of 395.40 g/mol. Its IUPAC name is 1-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-3-(2-piperidin-1-ylphenyl)urea.
| Compound Name | 1-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-3-(2-piperidin-1-ylphenyl)urea |
|---|---|
| PubChem CID | 55696395 |
| Molecular Formula | C20H21F4N3O |
| Molecular Weight | 395.40 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | 1-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-3-(2-piperidin-1-ylphenyl)urea |
| SMILES | O=C(NCc1ccc(F)cc1C(F)(F)F)Nc1ccccc1N1CCCCC1 |
| InChI | InChI=1S/C20H21F4N3O/c21-15-9-8-14(16(12-15)20(22,23)24)13-25-19(28)26-17-6-2-3-7-18(17)27-10-4-1-5-11-27/h2-3,6-9,12H,1,4-5,10-11,13H2,(H2,25,26,28) |
| InChIKey | TYVZGLCETHUHKJ-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.40 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |