C18H14F4N4O — CID 55696108
1-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-3-(1-phenylpyrazol-3-yl)urea (PubChem CID 55696108) has the molecular formula C18H14F4N4O and a molecular weight of 378.33 g/mol. Its IUPAC name is 1-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-3-(1-phenylpyrazol-3-yl)urea.
| Compound Name | 1-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-3-(1-phenylpyrazol-3-yl)urea |
|---|---|
| PubChem CID | 55696108 |
| Molecular Formula | C18H14F4N4O |
| Molecular Weight | 378.33 g/mol |
| Exact Mass | 378.11 |
| IUPAC Name | 1-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-3-(1-phenylpyrazol-3-yl)urea |
| SMILES | O=C(NCc1ccc(F)cc1C(F)(F)F)Nc1ccn(-c2ccccc2)n1 |
| InChI | InChI=1S/C18H14F4N4O/c19-13-7-6-12(15(10-13)18(20,21)22)11-23-17(27)24-16-8-9-26(25-16)14-4-2-1-3-5-14/h1-10H,11H2,(H2,23,24,25,27) |
| InChIKey | HQSZXQZGOCBRMX-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.33 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |