C17H19N7O — CID 53499346
1-(1-phenylpyrazol-3-yl)-3-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)urea (PubChem CID 53499346) has the molecular formula C17H19N7O and a molecular weight of 337.39 g/mol. Its IUPAC name is 1-(1-phenylpyrazol-3-yl)-3-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)urea.
| Compound Name | 1-(1-phenylpyrazol-3-yl)-3-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)urea |
|---|---|
| PubChem CID | 53499346 |
| Molecular Formula | C17H19N7O |
| Molecular Weight | 337.39 g/mol |
| Exact Mass | 337.17 |
| IUPAC Name | 1-(1-phenylpyrazol-3-yl)-3-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)urea |
| SMILES | O=C(NCc1nnc2n1CCCC2)Nc1ccn(-c2ccccc2)n1 |
| InChI | InChI=1S/C17H19N7O/c25-17(18-12-16-21-20-15-8-4-5-10-23(15)16)19-14-9-11-24(22-14)13-6-2-1-3-7-13/h1-3,6-7,9,11H,4-5,8,10,12H2,(H2,18,19,22,25) |
| InChIKey | AGQMEVVIZCBAOK-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 89.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.39 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |