C17H23N5O2 — CID 110937101
1-(2-hydroxy-3-phenylpropyl)-3-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)urea (PubChem CID 110937101) has the molecular formula C17H23N5O2 and a molecular weight of 329.40 g/mol. Its IUPAC name is 1-(2-hydroxy-3-phenylpropyl)-3-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)urea.
| Compound Name | 1-(2-hydroxy-3-phenylpropyl)-3-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)urea |
|---|---|
| PubChem CID | 110937101 |
| Molecular Formula | C17H23N5O2 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.19 |
| IUPAC Name | 1-(2-hydroxy-3-phenylpropyl)-3-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)urea |
| SMILES | O=C(NCc1nnc2n1CCCC2)NCC(O)Cc1ccccc1 |
| InChI | InChI=1S/C17H23N5O2/c23-14(10-13-6-2-1-3-7-13)11-18-17(24)19-12-16-21-20-15-8-4-5-9-22(15)16/h1-3,6-7,14,23H,4-5,8-12H2,(H2,18,19,24) |
| InChIKey | CBWPHVDDHOCXRG-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 92.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |