C15H17F2N5O2 — CID 97076666
1-[(2S)-2-(3,4-difluorophenyl)-2-hydroxyethyl]-3-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)urea (PubChem CID 97076666) has the molecular formula C15H17F2N5O2 and a molecular weight of 337.33 g/mol. Its IUPAC name is 1-[(2S)-2-(3,4-difluorophenyl)-2-hydroxyethyl]-3-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)urea.
| Compound Name | 1-[(2S)-2-(3,4-difluorophenyl)-2-hydroxyethyl]-3-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)urea |
|---|---|
| PubChem CID | 97076666 |
| Molecular Formula | C15H17F2N5O2 |
| Molecular Weight | 337.33 g/mol |
| Exact Mass | 337.14 |
| IUPAC Name | 1-[(2S)-2-(3,4-difluorophenyl)-2-hydroxyethyl]-3-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)urea |
| SMILES | O=C(NCc1nnc2n1CCC2)NC[C@@H](O)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C15H17F2N5O2/c16-10-4-3-9(6-11(10)17)12(23)7-18-15(24)19-8-14-21-20-13-2-1-5-22(13)14/h3-4,6,12,23H,1-2,5,7-8H2,(H2,18,19,24)/t12-/m1/s1 |
| InChIKey | CFIXBYYQYNAHIY-GFCCVEGCSA-N |
| XLogP | 1.04 |
| TPSA | 92.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.33 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |