C16H23FN4 — CID 111521609
1-[(5-cyano-2-fluorophenyl)methyl]-2-methyl-3-(4-methylpentyl)guanidine (PubChem CID 111521609) has the molecular formula C16H23FN4 and a molecular weight of 290.39 g/mol. Its IUPAC name is 1-[(5-cyano-2-fluorophenyl)methyl]-2-methyl-3-(4-methylpentyl)guanidine.
| Compound Name | 1-[(5-cyano-2-fluorophenyl)methyl]-2-methyl-3-(4-methylpentyl)guanidine |
|---|---|
| PubChem CID | 111521609 |
| Molecular Formula | C16H23FN4 |
| Molecular Weight | 290.39 g/mol |
| Exact Mass | 290.19 |
| IUPAC Name | 1-[(5-cyano-2-fluorophenyl)methyl]-2-methyl-3-(4-methylpentyl)guanidine |
| SMILES | C/N=C(\NCCCC(C)C)NCc1cc(C#N)ccc1F |
| InChI | InChI=1S/C16H23FN4/c1-12(2)5-4-8-20-16(19-3)21-11-14-9-13(10-18)6-7-15(14)17/h6-7,9,12H,4-5,8,11H2,1-3H3,(H2,19,20,21) |
| InChIKey | IWOOHQRJJOFYNW-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 60.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.39 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|