C18H23FN6 — CID 111498492
1-[(5-cyano-2-fluorophenyl)methyl]-3-[3-(3,5-dimethylpyrazol-1-yl)propyl]-2-methylguanidine (PubChem CID 111498492) has the molecular formula C18H23FN6 and a molecular weight of 342.42 g/mol. Its IUPAC name is 1-[(5-cyano-2-fluorophenyl)methyl]-3-[3-(3,5-dimethylpyrazol-1-yl)propyl]-2-methylguanidine.
| Compound Name | 1-[(5-cyano-2-fluorophenyl)methyl]-3-[3-(3,5-dimethylpyrazol-1-yl)propyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111498492 |
| Molecular Formula | C18H23FN6 |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.20 |
| IUPAC Name | 1-[(5-cyano-2-fluorophenyl)methyl]-3-[3-(3,5-dimethylpyrazol-1-yl)propyl]-2-methylguanidine |
| SMILES | C/N=C(\NCCCn1nc(C)cc1C)NCc1cc(C#N)ccc1F |
| InChI | InChI=1S/C18H23FN6/c1-13-9-14(2)25(24-13)8-4-7-22-18(21-3)23-12-16-10-15(11-20)5-6-17(16)19/h5-6,9-10H,4,7-8,12H2,1-3H3,(H2,21,22,23) |
| InChIKey | YIPNSUROABXGQG-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 78.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|