C16H24N4O2 — CID 134033685
3-(4-benzyl-1,4-diazepan-1-yl)-N-carbamoylpropanamide (PubChem CID 134033685) has the molecular formula C16H24N4O2 and a molecular weight of 304.39 g/mol. Its IUPAC name is 3-(4-benzyl-1,4-diazepan-1-yl)-N-carbamoylpropanamide.
| Compound Name | 3-(4-benzyl-1,4-diazepan-1-yl)-N-carbamoylpropanamide |
|---|---|
| PubChem CID | 134033685 |
| Molecular Formula | C16H24N4O2 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.19 |
| IUPAC Name | 3-(4-benzyl-1,4-diazepan-1-yl)-N-carbamoylpropanamide |
| SMILES | NC(=O)NC(=O)CCN1CCCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C16H24N4O2/c17-16(22)18-15(21)7-10-19-8-4-9-20(12-11-19)13-14-5-2-1-3-6-14/h1-3,5-6H,4,7-13H2,(H3,17,18,21,22) |
| InChIKey | GINOIOYHQRUMAS-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |