C28H30Cl2N4O2 — CID 5112014
3-(4-benzhydrylpiperazin-1-yl)-N'-[2-(3,4-dichlorophenyl)acetyl]propanehydrazide (PubChem CID 5112014) has the molecular formula C28H30Cl2N4O2 and a molecular weight of 525.48 g/mol. Its IUPAC name is 3-(4-benzhydrylpiperazin-1-yl)-N'-[2-(3,4-dichlorophenyl)acetyl]propanehydrazide.
| Compound Name | 3-(4-benzhydrylpiperazin-1-yl)-N'-[2-(3,4-dichlorophenyl)acetyl]propanehydrazide |
|---|---|
| PubChem CID | 5112014 |
| Molecular Formula | C28H30Cl2N4O2 |
| Molecular Weight | 525.48 g/mol |
| Exact Mass | 524.17 |
| IUPAC Name | 3-(4-benzhydrylpiperazin-1-yl)-N'-[2-(3,4-dichlorophenyl)acetyl]propanehydrazide |
| SMILES | O=C(CCN1CCN(C(c2ccccc2)c2ccccc2)CC1)NNC(=O)Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C28H30Cl2N4O2/c29-24-12-11-21(19-25(24)30)20-27(36)32-31-26(35)13-14-33-15-17-34(18-16-33)28(22-7-3-1-4-8-22)23-9-5-2-6-10-23/h1-12,19,28H,13-18,20H2,(H,31,35)(H,32,36) |
| InChIKey | GEZWHLQNVLFKEP-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.48 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|