C29H31ClN4O2 — CID 6109897
3-(4-benzhydrylpiperazin-1-yl)-N'-[(E)-3-(2-chlorophenyl)prop-2-enoyl]propanehydrazide (PubChem CID 6109897) has the molecular formula C29H31ClN4O2 and a molecular weight of 503.05 g/mol. Its IUPAC name is 3-(4-benzhydrylpiperazin-1-yl)-N'-[(E)-3-(2-chlorophenyl)prop-2-enoyl]propanehydrazide.
| Compound Name | 3-(4-benzhydrylpiperazin-1-yl)-N'-[(E)-3-(2-chlorophenyl)prop-2-enoyl]propanehydrazide |
|---|---|
| PubChem CID | 6109897 |
| Molecular Formula | C29H31ClN4O2 |
| Molecular Weight | 503.05 g/mol |
| Exact Mass | 502.21 |
| IUPAC Name | 3-(4-benzhydrylpiperazin-1-yl)-N'-[(E)-3-(2-chlorophenyl)prop-2-enoyl]propanehydrazide |
| SMILES | O=C(/C=C/c1ccccc1Cl)NNC(=O)CCN1CCN(C(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C29H31ClN4O2/c30-26-14-8-7-9-23(26)15-16-27(35)31-32-28(36)17-18-33-19-21-34(22-20-33)29(24-10-3-1-4-11-24)25-12-5-2-6-13-25/h1-16,29H,17-22H2,(H,31,35)(H,32,36)/b16-15+ |
| InChIKey | QKANOCUVLMERSJ-FOCLMDBBSA-N |
| XLogP | 4.30 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.05 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|