C23H28N4O3 — CID 7551049
N'-[(E)-3-(2-methoxyphenyl)prop-2-enoyl]-3-(4-phenylpiperazin-1-yl)propanehydrazide (PubChem CID 7551049) has the molecular formula C23H28N4O3 and a molecular weight of 408.50 g/mol. Its IUPAC name is N'-[(E)-3-(2-methoxyphenyl)prop-2-enoyl]-3-(4-phenylpiperazin-1-yl)propanehydrazide.
| Compound Name | N'-[(E)-3-(2-methoxyphenyl)prop-2-enoyl]-3-(4-phenylpiperazin-1-yl)propanehydrazide |
|---|---|
| PubChem CID | 7551049 |
| Molecular Formula | C23H28N4O3 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.22 |
| IUPAC Name | N'-[(E)-3-(2-methoxyphenyl)prop-2-enoyl]-3-(4-phenylpiperazin-1-yl)propanehydrazide |
| SMILES | COc1ccccc1/C=C/C(=O)NNC(=O)CCN1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C23H28N4O3/c1-30-21-10-6-5-7-19(21)11-12-22(28)24-25-23(29)13-14-26-15-17-27(18-16-26)20-8-3-2-4-9-20/h2-12H,13-18H2,1H3,(H,24,28)(H,25,29)/b12-11+ |
| InChIKey | CAAGFRPDJQXHHA-VAWYXSNFSA-N |
| XLogP | 2.07 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|