C34H40N6O7P+ — CID 175450879
bis[(E)-[1-(6,7-dimethoxyquinazolin-4-yl)azepan-4-ylidene]methoxy]-oxophosphanium (PubChem CID 175450879) has the molecular formula C34H40N6O7P+ and a molecular weight of 675.70 g/mol. Its IUPAC name is bis[(E)-[1-(6,7-dimethoxyquinazolin-4-yl)azepan-4-ylidene]methoxy]-oxophosphanium.
| Compound Name | bis[(E)-[1-(6,7-dimethoxyquinazolin-4-yl)azepan-4-ylidene]methoxy]-oxophosphanium |
|---|---|
| PubChem CID | 175450879 |
| Molecular Formula | C34H40N6O7P+ |
| Molecular Weight | 675.70 g/mol |
| Exact Mass | 675.27 |
| IUPAC Name | bis[(E)-[1-(6,7-dimethoxyquinazolin-4-yl)azepan-4-ylidene]methoxy]-oxophosphanium |
| SMILES | COc1cc2ncnc(N3CCC/C(=C\O[P+](=O)O/C=C4\CCCN(c5ncnc6cc(OC)c(OC)cc56)CC4)CC3)c2cc1OC |
| InChI | InChI=1S/C34H40N6O7P/c1-42-29-15-25-27(17-31(29)44-3)35-21-37-33(25)39-11-5-7-23(9-13-39)19-46-48(41)47-20-24-8-6-12-40(14-10-24)34-26-16-30(43-2)32(45-4)18-28(26)36-22-38-34/h15-22H,5-14H2,1-4H3/q+1/b23-19+,24-20+ |
| InChIKey | WJKMLEDFIHWKSY-BLVCXSLXSA-N |
| XLogP | 6.75 |
| TPSA | 130.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.70 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|