C29H36ClN5O2S2 — CID 71549058
(4-chlorophenyl)methyl 4-[6-methoxy-7-(3-piperidin-1-ylpropoxy)quinazolin-4-yl]piperazine-1-carbodithioate (PubChem CID 71549058) has the molecular formula C29H36ClN5O2S2 and a molecular weight of 586.23 g/mol. Its IUPAC name is (4-chlorophenyl)methyl 4-[6-methoxy-7-(3-piperidin-1-ylpropoxy)quinazolin-4-yl]piperazine-1-carbodithioate.
| Compound Name | (4-chlorophenyl)methyl 4-[6-methoxy-7-(3-piperidin-1-ylpropoxy)quinazolin-4-yl]piperazine-1-carbodithioate |
|---|---|
| PubChem CID | 71549058 |
| Molecular Formula | C29H36ClN5O2S2 |
| Molecular Weight | 586.23 g/mol |
| Exact Mass | 585.20 |
| IUPAC Name | (4-chlorophenyl)methyl 4-[6-methoxy-7-(3-piperidin-1-ylpropoxy)quinazolin-4-yl]piperazine-1-carbodithioate |
| SMILES | COc1cc2c(N3CCN(C(=S)SCc4ccc(Cl)cc4)CC3)ncnc2cc1OCCCN1CCCCC1 |
| InChI | InChI=1S/C29H36ClN5O2S2/c1-36-26-18-24-25(19-27(26)37-17-5-12-33-10-3-2-4-11-33)31-21-32-28(24)34-13-15-35(16-14-34)29(38)39-20-22-6-8-23(30)9-7-22/h6-9,18-19,21H,2-5,10-17,20H2,1H3 |
| InChIKey | DKSGYLFPFUQGHM-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 53.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.23 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|