C27H35N5O3S2 — CID 155557711
furan-2-ylmethyl 4-[6-methoxy-7-(3-piperidin-1-ylpropoxy)quinazolin-4-yl]piperazine-1-carbodithioate (PubChem CID 155557711) has the molecular formula C27H35N5O3S2 and a molecular weight of 541.74 g/mol. Its IUPAC name is furan-2-ylmethyl 4-[6-methoxy-7-(3-piperidin-1-ylpropoxy)quinazolin-4-yl]piperazine-1-carbodithioate.
| Compound Name | furan-2-ylmethyl 4-[6-methoxy-7-(3-piperidin-1-ylpropoxy)quinazolin-4-yl]piperazine-1-carbodithioate |
|---|---|
| PubChem CID | 155557711 |
| Molecular Formula | C27H35N5O3S2 |
| Molecular Weight | 541.74 g/mol |
| Exact Mass | 541.22 |
| IUPAC Name | furan-2-ylmethyl 4-[6-methoxy-7-(3-piperidin-1-ylpropoxy)quinazolin-4-yl]piperazine-1-carbodithioate |
| SMILES | COc1cc2c(N3CCN(C(=S)SCc4ccco4)CC3)ncnc2cc1OCCCN1CCCCC1 |
| InChI | InChI=1S/C27H35N5O3S2/c1-33-24-17-22-23(18-25(24)35-16-6-10-30-8-3-2-4-9-30)28-20-29-26(22)31-11-13-32(14-12-31)27(36)37-19-21-7-5-15-34-21/h5,7,15,17-18,20H,2-4,6,8-14,16,19H2,1H3 |
| InChIKey | XHVYCIYMBKYMNT-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 67.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.74 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|