C18H17ClN4O4 — CID 68544982
N-[7-(3-chloropropoxy)-6-methoxyquinazolin-4-yl]-[1,3]dioxolo[4,5-b]pyridin-7-amine (PubChem CID 68544982) has the molecular formula C18H17ClN4O4 and a molecular weight of 388.81 g/mol. Its IUPAC name is N-[7-(3-chloropropoxy)-6-methoxyquinazolin-4-yl]-[1,3]dioxolo[4,5-b]pyridin-7-amine.
| Compound Name | N-[7-(3-chloropropoxy)-6-methoxyquinazolin-4-yl]-[1,3]dioxolo[4,5-b]pyridin-7-amine |
|---|---|
| PubChem CID | 68544982 |
| Molecular Formula | C18H17ClN4O4 |
| Molecular Weight | 388.81 g/mol |
| Exact Mass | 388.09 |
| IUPAC Name | N-[7-(3-chloropropoxy)-6-methoxyquinazolin-4-yl]-[1,3]dioxolo[4,5-b]pyridin-7-amine |
| SMILES | COc1cc2c(Nc3ccnc4c3OCO4)ncnc2cc1OCCCCl |
| InChI | InChI=1S/C18H17ClN4O4/c1-24-14-7-11-13(8-15(14)25-6-2-4-19)21-9-22-17(11)23-12-3-5-20-18-16(12)26-10-27-18/h3,5,7-9H,2,4,6,10H2,1H3,(H,20,21,22,23) |
| InChIKey | NEROTQYRBSRTPB-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 87.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.81 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|