C23H21N7O4S — CID 59020544
1-(1,3-benzodioxol-5-ylmethyl)-3-[5-[(6,7-dimethoxyquinazolin-4-yl)amino]pyrimidin-2-yl]thiourea (PubChem CID 59020544) has the molecular formula C23H21N7O4S and a molecular weight of 491.53 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-ylmethyl)-3-[5-[(6,7-dimethoxyquinazolin-4-yl)amino]pyrimidin-2-yl]thiourea.
| Compound Name | 1-(1,3-benzodioxol-5-ylmethyl)-3-[5-[(6,7-dimethoxyquinazolin-4-yl)amino]pyrimidin-2-yl]thiourea |
|---|---|
| PubChem CID | 59020544 |
| Molecular Formula | C23H21N7O4S |
| Molecular Weight | 491.53 g/mol |
| Exact Mass | 491.14 |
| IUPAC Name | 1-(1,3-benzodioxol-5-ylmethyl)-3-[5-[(6,7-dimethoxyquinazolin-4-yl)amino]pyrimidin-2-yl]thiourea |
| SMILES | COc1cc2ncnc(Nc3cnc(NC(=S)NCc4ccc5c(c4)OCO5)nc3)c2cc1OC |
| InChI | InChI=1S/C23H21N7O4S/c1-31-18-6-15-16(7-19(18)32-2)27-11-28-21(15)29-14-9-24-22(25-10-14)30-23(35)26-8-13-3-4-17-20(5-13)34-12-33-17/h3-7,9-11H,8,12H2,1-2H3,(H,27,28,29)(H2,24,25,26,30,35) |
| InChIKey | WBZFATJGQQOBIB-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 124.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.53 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|