C22H21N7O4S — CID 89167840
1-[(3,4-dihydroxyphenyl)methyl]-3-[5-[(6,7-dimethoxyquinazolin-4-yl)amino]pyrimidin-2-yl]thiourea (PubChem CID 89167840) has the molecular formula C22H21N7O4S and a molecular weight of 479.52 g/mol. Its IUPAC name is 1-[(3,4-dihydroxyphenyl)methyl]-3-[5-[(6,7-dimethoxyquinazolin-4-yl)amino]pyrimidin-2-yl]thiourea.
| Compound Name | 1-[(3,4-dihydroxyphenyl)methyl]-3-[5-[(6,7-dimethoxyquinazolin-4-yl)amino]pyrimidin-2-yl]thiourea |
|---|---|
| PubChem CID | 89167840 |
| Molecular Formula | C22H21N7O4S |
| Molecular Weight | 479.52 g/mol |
| Exact Mass | 479.14 |
| IUPAC Name | 1-[(3,4-dihydroxyphenyl)methyl]-3-[5-[(6,7-dimethoxyquinazolin-4-yl)amino]pyrimidin-2-yl]thiourea |
| SMILES | COc1cc2ncnc(Nc3cnc(NC(=S)NCc4ccc(O)c(O)c4)nc3)c2cc1OC |
| InChI | InChI=1S/C22H21N7O4S/c1-32-18-6-14-15(7-19(18)33-2)26-11-27-20(14)28-13-9-23-21(24-10-13)29-22(34)25-8-12-3-4-16(30)17(31)5-12/h3-7,9-11,30-31H,8H2,1-2H3,(H,26,27,28)(H2,23,24,25,29,34) |
| InChIKey | JDEWGKOLZSGWLT-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 146.57 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.52 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|