C24H28Cl2FN5O2 — CID 140765458
6-[3-[(3aR,6aR)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl]propoxy]-N-(3-chloro-2-fluorophenyl)-7-methoxyquinazolin-4-amine;hydrochloride (PubChem CID 140765458) has the molecular formula C24H28Cl2FN5O2 and a molecular weight of 508.43 g/mol. Its IUPAC name is 6-[3-[(3aR,6aR)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl]propoxy]-N-(3-chloro-2-fluorophenyl)-7-methoxyquinazolin-4-amine;hydrochloride.
| Compound Name | 6-[3-[(3aR,6aR)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl]propoxy]-N-(3-chloro-2-fluorophenyl)-7-methoxyquinazolin-4-amine;hydrochloride |
|---|---|
| PubChem CID | 140765458 |
| Molecular Formula | C24H28Cl2FN5O2 |
| Molecular Weight | 508.43 g/mol |
| Exact Mass | 507.16 |
| IUPAC Name | 6-[3-[(3aR,6aR)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl]propoxy]-N-(3-chloro-2-fluorophenyl)-7-methoxyquinazolin-4-amine;hydrochloride |
| SMILES | COc1cc2ncnc(Nc3cccc(Cl)c3F)c2cc1OCCCN1CC[C@@H]2CNC[C@@H]21.Cl |
| InChI | InChI=1S/C24H27ClFN5O2.ClH/c1-32-21-11-19-16(24(29-14-28-19)30-18-5-2-4-17(25)23(18)26)10-22(21)33-9-3-7-31-8-6-15-12-27-13-20(15)31;/h2,4-5,10-11,14-15,20,27H,3,6-9,12-13H2,1H3,(H,28,29,30);1H/t15-,20+;/m1./s1 |
| InChIKey | RYPCFESZCBYIGE-SWFRRQLPSA-N |
| XLogP | 4.66 |
| TPSA | 71.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.43 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|