C24H29Cl3FN5O2 — CID 161464071
6-[3-[(3aS,6aS)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl]propoxy]-N-(3-chloro-2-fluorophenyl)-7-methoxyquinazolin-4-amine;dihydrochloride (PubChem CID 161464071) has the molecular formula C24H29Cl3FN5O2 and a molecular weight of 544.89 g/mol. Its IUPAC name is 6-[3-[(3aS,6aS)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl]propoxy]-N-(3-chloro-2-fluorophenyl)-7-methoxyquinazolin-4-amine;dihydrochloride.
| Compound Name | 6-[3-[(3aS,6aS)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl]propoxy]-N-(3-chloro-2-fluorophenyl)-7-methoxyquinazolin-4-amine;dihydrochloride |
|---|---|
| PubChem CID | 161464071 |
| Molecular Formula | C24H29Cl3FN5O2 |
| Molecular Weight | 544.89 g/mol |
| Exact Mass | 543.14 |
| IUPAC Name | 6-[3-[(3aS,6aS)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl]propoxy]-N-(3-chloro-2-fluorophenyl)-7-methoxyquinazolin-4-amine;dihydrochloride |
| SMILES | COc1cc2ncnc(Nc3cccc(Cl)c3F)c2cc1OCCCN1CC[C@H]2CNC[C@H]21.Cl.Cl |
| InChI | InChI=1S/C24H27ClFN5O2.2ClH/c1-32-21-11-19-16(24(29-14-28-19)30-18-5-2-4-17(25)23(18)26)10-22(21)33-9-3-7-31-8-6-15-12-27-13-20(15)31;;/h2,4-5,10-11,14-15,20,27H,3,6-9,12-13H2,1H3,(H,28,29,30);2*1H/t15-,20+;;/m0../s1 |
| InChIKey | SKXUXWHELPXJBC-VRFXWXFCSA-N |
| XLogP | 5.08 |
| TPSA | 71.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.89 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|