C18H22ClN5O4 — CID 142260062
(Z)-5-[[7-(3-chloropropoxy)-6-methoxyquinazolin-4-yl]amino]-5-(2-methylidenehydrazinyl)pent-4-enoic acid (PubChem CID 142260062) has the molecular formula C18H22ClN5O4 and a molecular weight of 407.86 g/mol. Its IUPAC name is (Z)-5-[[7-(3-chloropropoxy)-6-methoxyquinazolin-4-yl]amino]-5-(2-methylidenehydrazinyl)pent-4-enoic acid.
| Compound Name | (Z)-5-[[7-(3-chloropropoxy)-6-methoxyquinazolin-4-yl]amino]-5-(2-methylidenehydrazinyl)pent-4-enoic acid |
|---|---|
| PubChem CID | 142260062 |
| Molecular Formula | C18H22ClN5O4 |
| Molecular Weight | 407.86 g/mol |
| Exact Mass | 407.14 |
| IUPAC Name | (Z)-5-[[7-(3-chloropropoxy)-6-methoxyquinazolin-4-yl]amino]-5-(2-methylidenehydrazinyl)pent-4-enoic acid |
| SMILES | C=NN/C(=C\CCC(=O)O)Nc1ncnc2cc(OCCCCl)c(OC)cc12 |
| InChI | InChI=1S/C18H22ClN5O4/c1-20-24-16(5-3-6-17(25)26)23-18-12-9-14(27-2)15(28-8-4-7-19)10-13(12)21-11-22-18/h5,9-11,24H,1,3-4,6-8H2,2H3,(H,25,26)(H,21,22,23)/b16-5- |
| InChIKey | GLAKJSYLUXSPEC-BNCCVWRVSA-N |
| XLogP | 2.97 |
| TPSA | 117.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.86 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|