C21H15N3OS — CID 18383036
N-(3-ethynylphenyl)-6-(4-methoxyphenyl)thieno[3,2-d]pyrimidin-4-amine (PubChem CID 18383036) has the molecular formula C21H15N3OS and a molecular weight of 357.44 g/mol. Its IUPAC name is N-(3-ethynylphenyl)-6-(4-methoxyphenyl)thieno[3,2-d]pyrimidin-4-amine.
| Compound Name | N-(3-ethynylphenyl)-6-(4-methoxyphenyl)thieno[3,2-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 18383036 |
| Molecular Formula | C21H15N3OS |
| Molecular Weight | 357.44 g/mol |
| Exact Mass | 357.09 |
| IUPAC Name | N-(3-ethynylphenyl)-6-(4-methoxyphenyl)thieno[3,2-d]pyrimidin-4-amine |
| SMILES | C#Cc1cccc(Nc2ncnc3cc(-c4ccc(OC)cc4)sc23)c1 |
| InChI | InChI=1S/C21H15N3OS/c1-3-14-5-4-6-16(11-14)24-21-20-18(22-13-23-21)12-19(26-20)15-7-9-17(25-2)10-8-15/h1,4-13H,2H3,(H,22,23,24) |
| InChIKey | OLIDNXWCIKAEEA-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.44 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|