C27H21N3O3S — CID 89438870
3-[4-[3-[(4-methoxyphenyl)methoxy]anilino]thieno[3,2-d]pyrimidin-6-yl]benzaldehyde (PubChem CID 89438870) has the molecular formula C27H21N3O3S and a molecular weight of 467.55 g/mol. Its IUPAC name is 3-[4-[3-[(4-methoxyphenyl)methoxy]anilino]thieno[3,2-d]pyrimidin-6-yl]benzaldehyde.
| Compound Name | 3-[4-[3-[(4-methoxyphenyl)methoxy]anilino]thieno[3,2-d]pyrimidin-6-yl]benzaldehyde |
|---|---|
| PubChem CID | 89438870 |
| Molecular Formula | C27H21N3O3S |
| Molecular Weight | 467.55 g/mol |
| Exact Mass | 467.13 |
| IUPAC Name | 3-[4-[3-[(4-methoxyphenyl)methoxy]anilino]thieno[3,2-d]pyrimidin-6-yl]benzaldehyde |
| SMILES | COc1ccc(COc2cccc(Nc3ncnc4cc(-c5cccc(C=O)c5)sc34)c2)cc1 |
| InChI | InChI=1S/C27H21N3O3S/c1-32-22-10-8-18(9-11-22)16-33-23-7-3-6-21(13-23)30-27-26-24(28-17-29-27)14-25(34-26)20-5-2-4-19(12-20)15-31/h2-15,17H,16H2,1H3,(H,28,29,30) |
| InChIKey | VDWACLQODIHLIH-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.55 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|