C22H13F3N4O4 — CID 121273672
4-(6-nitroquinolin-4-yl)oxy-N-[4-(trifluoromethyl)-2-pyridinyl]benzamide (PubChem CID 121273672) has the molecular formula C22H13F3N4O4 and a molecular weight of 454.36 g/mol. Its IUPAC name is 4-(6-nitroquinolin-4-yl)oxy-N-[4-(trifluoromethyl)-2-pyridinyl]benzamide.
| Compound Name | 4-(6-nitroquinolin-4-yl)oxy-N-[4-(trifluoromethyl)-2-pyridinyl]benzamide |
|---|---|
| PubChem CID | 121273672 |
| Molecular Formula | C22H13F3N4O4 |
| Molecular Weight | 454.36 g/mol |
| Exact Mass | 454.09 |
| IUPAC Name | 4-(6-nitroquinolin-4-yl)oxy-N-[4-(trifluoromethyl)-2-pyridinyl]benzamide |
| SMILES | O=C(Nc1cc(C(F)(F)F)ccn1)c1ccc(Oc2ccnc3ccc([N+](=O)[O-])cc23)cc1 |
| InChI | InChI=1S/C22H13F3N4O4/c23-22(24,25)14-7-9-27-20(11-14)28-21(30)13-1-4-16(5-2-13)33-19-8-10-26-18-6-3-15(29(31)32)12-17(18)19/h1-12H,(H,27,28,30) |
| InChIKey | MHXJVVAZOSDLFV-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 107.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.36 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|