C21H25F3N4O2S — CID 46113866
N-[3-(2-methylpiperidin-1-yl)propyl]-2-[[3-(trifluoromethyl)benzoyl]amino]-1,3-thiazole-4-carboxamide (PubChem CID 46113866) has the molecular formula C21H25F3N4O2S and a molecular weight of 454.52 g/mol. Its IUPAC name is N-[3-(2-methylpiperidin-1-yl)propyl]-2-[[3-(trifluoromethyl)benzoyl]amino]-1,3-thiazole-4-carboxamide.
| Compound Name | N-[3-(2-methylpiperidin-1-yl)propyl]-2-[[3-(trifluoromethyl)benzoyl]amino]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 46113866 |
| Molecular Formula | C21H25F3N4O2S |
| Molecular Weight | 454.52 g/mol |
| Exact Mass | 454.17 |
| IUPAC Name | N-[3-(2-methylpiperidin-1-yl)propyl]-2-[[3-(trifluoromethyl)benzoyl]amino]-1,3-thiazole-4-carboxamide |
| SMILES | CC1CCCCN1CCCNC(=O)c1csc(NC(=O)c2cccc(C(F)(F)F)c2)n1 |
| InChI | InChI=1S/C21H25F3N4O2S/c1-14-6-2-3-10-28(14)11-5-9-25-19(30)17-13-31-20(26-17)27-18(29)15-7-4-8-16(12-15)21(22,23)24/h4,7-8,12-14H,2-3,5-6,9-11H2,1H3,(H,25,30)(H,26,27,29) |
| InChIKey | HCPQJJMJAIAVFL-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.52 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|