C22H25F3N4O — CID 3454281
3-cyano-N-[3-(2-methylpiperidin-1-yl)propyl]-1-[3-(trifluoromethyl)phenyl]pyrrole-2-carboxamide (PubChem CID 3454281) has the molecular formula C22H25F3N4O and a molecular weight of 418.46 g/mol. Its IUPAC name is 3-cyano-N-[3-(2-methylpiperidin-1-yl)propyl]-1-[3-(trifluoromethyl)phenyl]pyrrole-2-carboxamide.
| Compound Name | 3-cyano-N-[3-(2-methylpiperidin-1-yl)propyl]-1-[3-(trifluoromethyl)phenyl]pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 3454281 |
| Molecular Formula | C22H25F3N4O |
| Molecular Weight | 418.46 g/mol |
| Exact Mass | 418.20 |
| IUPAC Name | 3-cyano-N-[3-(2-methylpiperidin-1-yl)propyl]-1-[3-(trifluoromethyl)phenyl]pyrrole-2-carboxamide |
| SMILES | CC1CCCCN1CCCNC(=O)c1c(C#N)ccn1-c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C22H25F3N4O/c1-16-6-2-3-11-28(16)12-5-10-27-21(30)20-17(15-26)9-13-29(20)19-8-4-7-18(14-19)22(23,24)25/h4,7-9,13-14,16H,2-3,5-6,10-12H2,1H3,(H,27,30) |
| InChIKey | QMLDUFDHZOBNST-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 61.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.46 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|